C21H33FN4O3 — CID 137467895
5-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-N-[(2-methoxyethylamino)methyl]-4-methyl-5-oxopentanamide (PubChem CID 137467895) has the molecular formula C21H33FN4O3 and a molecular weight of 408.52 g/mol. Its IUPAC name is 5-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-N-[(2-methoxyethylamino)methyl]-4-methyl-5-oxopentanamide.
| Compound Name | 5-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-N-[(2-methoxyethylamino)methyl]-4-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 137467895 |
| Molecular Formula | C21H33FN4O3 |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 5-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-N-[(2-methoxyethylamino)methyl]-4-methyl-5-oxopentanamide |
| SMILES | COCCNCNC(=O)CCC(C)C(=O)N1CCN(c2cccc(F)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C21H33FN4O3/c1-16(7-8-20(27)24-15-23-9-12-29-3)21(28)25-10-11-26(17(2)14-25)19-6-4-5-18(22)13-19/h4-6,13,16-17,23H,7-12,14-15H2,1-3H3,(H,24,27)/t16?,17-/m0/s1 |
| InChIKey | JKPBVVDQCIKPKD-DJNXLDHESA-N |
| XLogP | 1.59 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|