About 2-methylpropyl 3-oxopentanimidate
2-methylpropyl 3-oxopentanimidate (PubChem CID 137470668) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-methylpropyl 3-oxopentanimidate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-oxopentanimidate |
| PubChem CID | 137470668 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 2-methylpropyl 3-oxopentanimidate |
| SMILES | [H]/N=C(/CC(=O)CC)OCC(C)C |
| InChI | InChI=1S/C9H17NO2/c1-4-8(11)5-9(10)12-6-7(2)3/h7,10H,4-6H2,1-3H3/b10-9- |
| InChIKey | AHRRQDJDHQTPIK-KTKRTIGZSA-N |
| XLogP | 2.01 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 3-oxopentanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-oxopentanimidate?
The IUPAC name of 2-methylpropyl 3-oxopentanimidate (CID 137470668) is 2-methylpropyl 3-oxopentanimidate.
What is the SMILES notation for 2-methylpropyl 3-oxopentanimidate?
The canonical SMILES for 2-methylpropyl 3-oxopentanimidate is [H]/N=C(/CC(=O)CC)OCC(C)C.
What is the InChIKey of 2-methylpropyl 3-oxopentanimidate?
The InChIKey is AHRRQDJDHQTPIK-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-8(11)5-9(10)12-6-7(2)3/h7,10H,4-6H2,1-3H3/b10-9-.
What are the key properties of 2-methylpropyl 3-oxopentanimidate?
2-methylpropyl 3-oxopentanimidate has a molecular weight of 171.24 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-oxopentanimidate is sourced from PubChem (CID 137470668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).