About 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate
2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate (PubChem CID 158794744) has the molecular formula C18H39NO2
and a molecular weight of 301.51 g/mol. Its IUPAC name is 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate.
Molecular Properties
| Compound Name | 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate |
| PubChem CID | 158794744 |
| Molecular Formula | C18H39NO2 |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.30 |
| IUPAC Name | 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate |
| SMILES | CCC(=O)CC(C)C.CCC(C)C.[H]/N=C(/CC(C)C)OC |
| InChI | InChI=1S/C7H14O.C6H13NO.C5H12/c1-4-7(8)5-6(2)3;1-5(2)4-6(7)8-3;1-4-5(2)3/h6H,4-5H2,1-3H3;5,7H,4H2,1-3H3;5H,4H2,1-3H3/b;7-6-; |
| InChIKey | ISSNPNFWZCVOMG-IICHUWEQSA-N |
| XLogP | 5.72 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate?
The IUPAC name of 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate (CID 158794744) is 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate.
What is the SMILES notation for 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate?
The canonical SMILES for 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate is CCC(=O)CC(C)C.CCC(C)C.[H]/N=C(/CC(C)C)OC.
What is the InChIKey of 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate?
The InChIKey is ISSNPNFWZCVOMG-IICHUWEQSA-N. The full InChI is InChI=1S/C7H14O.C6H13NO.C5H12/c1-4-7(8)5-6(2)3;1-5(2)4-6(7)8-3;1-4-5(2)3/h6H,4-5H2,1-3H3;5,7H,4H2,1-3H3;5H,4H2,1-3H3/b;7-6-;.
What are the key properties of 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate?
2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate has a molecular weight of 301.51 g/mol, XLogP of 5.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;5-methylhexan-3-one;methyl 3-methylbutanimidate is sourced from PubChem (CID 158794744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).