C31H28N4O9 — CID 137475823
N-[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 137475823) has the molecular formula C31H28N4O9 and a molecular weight of 600.58 g/mol. Its IUPAC name is N-[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 137475823 |
| Molecular Formula | C31H28N4O9 |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | N-[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cccc(NC(=O)c6ccno6)c5)c4C[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H28N4O9/c1-35(2)24-18-12-14-11-17-16(13-4-3-5-15(10-13)34-30(42)20-8-9-33-44-20)6-7-19(36)22(17)25(37)21(14)27(39)31(18,43)28(40)23(26(24)38)29(32)41/h3-10,14,18,24,36-37,40,43H,11-12H2,1-2H3,(H2,32,41)(H,34,42)/t14-,18+,24-,31+/m1/s1 |
| InChIKey | NALBCLNQSGXPJB-HRGNNRHYSA-N |
| XLogP | 1.87 |
| TPSA | 216.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|