C32H30N4O9 — CID 54719129
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[[2-(1,2-oxazol-5-yl)-2-oxoethyl]amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719129) has the molecular formula C32H30N4O9 and a molecular weight of 614.61 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[[2-(1,2-oxazol-5-yl)-2-oxoethyl]amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[[2-(1,2-oxazol-5-yl)-2-oxoethyl]amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719129 |
| Molecular Formula | C32H30N4O9 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[[2-(1,2-oxazol-5-yl)-2-oxoethyl]amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(NCC(=O)c6ccno6)cc5)c4CC3CC12 |
| InChI | InChI=1S/C32H30N4O9/c1-36(2)26-19-12-15-11-18-17(14-3-5-16(6-4-14)34-13-21(38)22-9-10-35-45-22)7-8-20(37)24(18)27(39)23(15)29(41)32(19,44)30(42)25(28(26)40)31(33)43/h3-10,15,19,26,34,37,39,42,44H,11-13H2,1-2H3,(H2,33,43) |
| InChIKey | BSFSKKBNTOYXDC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 216.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|