C15H9F3N4O2 — CID 137482094
3-[1-[(Z)-2-(1,2-oxazol-3-yl)ethenyl]-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzaldehyde (PubChem CID 137482094) has the molecular formula C15H9F3N4O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 3-[1-[(Z)-2-(1,2-oxazol-3-yl)ethenyl]-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzaldehyde.
| Compound Name | 3-[1-[(Z)-2-(1,2-oxazol-3-yl)ethenyl]-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 137482094 |
| Molecular Formula | C15H9F3N4O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[1-[(Z)-2-(1,2-oxazol-3-yl)ethenyl]-1,2,4-triazol-3-yl]-5-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1cc(-c2ncn(/C=C\c3ccon3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F3N4O2/c16-15(17,18)12-6-10(8-23)5-11(7-12)14-19-9-22(20-14)3-1-13-2-4-24-21-13/h1-9H/b3-1- |
| InChIKey | GHPZNWCLAUUKQT-IWQZZHSRSA-N |
| XLogP | 3.39 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|