C15H28N2O2 — CID 137495914
(2S)-2-amino-N,3,3-trimethyl-N-[(E,2S)-5-methyl-6-oxohept-4-en-2-yl]butanamide (PubChem CID 137495914) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S)-2-amino-N,3,3-trimethyl-N-[(E,2S)-5-methyl-6-oxohept-4-en-2-yl]butanamide.
| Compound Name | (2S)-2-amino-N,3,3-trimethyl-N-[(E,2S)-5-methyl-6-oxohept-4-en-2-yl]butanamide |
|---|---|
| PubChem CID | 137495914 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (2S)-2-amino-N,3,3-trimethyl-N-[(E,2S)-5-methyl-6-oxohept-4-en-2-yl]butanamide |
| SMILES | CC(=O)/C(C)=C/C[C@H](C)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-10(12(3)18)8-9-11(2)17(7)14(19)13(16)15(4,5)6/h8,11,13H,9,16H2,1-7H3/b10-8+/t11-,13+/m0/s1 |
| InChIKey | LUHHTGJFMIPDSU-YRFMYUJQSA-N |
| XLogP | 2.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|