C6H14N2O2 — CID 137498610
N,N-dimethylmethanamine;ethenylcarbamic acid (PubChem CID 137498610) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethenylcarbamic acid.
| Compound Name | N,N-dimethylmethanamine;ethenylcarbamic acid |
|---|---|
| PubChem CID | 137498610 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | N,N-dimethylmethanamine;ethenylcarbamic acid |
| SMILES | C=CNC(=O)O.CN(C)C |
| InChI | InChI=1S/C3H5NO2.C3H9N/c1-2-4-3(5)6;1-4(2)3/h2,4H,1H2,(H,5,6);1-3H3 |
| InChIKey | MBTVUQZDIHSKQQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |