N,N-dimethylmethanamine;ethenylcarbamic acid

C6H14N2O2 — CID 137498610

IUPACN,N-dimethylmethanamine;ethenylcarbamic acid
SMILESC=CNC(=O)O.CN(C)C
InChIInChI=1S/C3H5NO2.C3H9N/c1-2-4-3(5)6;1-4(2)3/h2,4H,1H2,(H,5,6);1-3H3
InChIKeyMBTVUQZDIHSKQQ-UHFFFAOYSA-N
MW146.19 g/mol
LogP0.58
Rot. Bonds1

About N,N-dimethylmethanamine;ethenylcarbamic acid

N,N-dimethylmethanamine;ethenylcarbamic acid (PubChem CID 137498610) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethenylcarbamic acid.

Molecular Properties

Compound NameN,N-dimethylmethanamine;ethenylcarbamic acid
PubChem CID137498610
Molecular FormulaC6H14N2O2
Molecular Weight146.19 g/mol
Exact Mass146.11
IUPAC NameN,N-dimethylmethanamine;ethenylcarbamic acid
SMILESC=CNC(=O)O.CN(C)C
InChIInChI=1S/C3H5NO2.C3H9N/c1-2-4-3(5)6;1-4(2)3/h2,4H,1H2,(H,5,6);1-3H3
InChIKeyMBTVUQZDIHSKQQ-UHFFFAOYSA-N
XLogP0.58
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 50.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze N,N-dimethylmethanamine;ethenylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylmethanamine;ethenylcarbamic acid?
The IUPAC name of N,N-dimethylmethanamine;ethenylcarbamic acid (CID 137498610) is N,N-dimethylmethanamine;ethenylcarbamic acid.
What is the SMILES notation for N,N-dimethylmethanamine;ethenylcarbamic acid?
The canonical SMILES for N,N-dimethylmethanamine;ethenylcarbamic acid is C=CNC(=O)O.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;ethenylcarbamic acid?
The InChIKey is MBTVUQZDIHSKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.C3H9N/c1-2-4-3(5)6;1-4(2)3/h2,4H,1H2,(H,5,6);1-3H3.
What are the key properties of N,N-dimethylmethanamine;ethenylcarbamic acid?
N,N-dimethylmethanamine;ethenylcarbamic acid has a molecular weight of 146.19 g/mol, XLogP of 0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;ethenylcarbamic acid is sourced from PubChem (CID 137498610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).