C22H21N3O4 — CID 137499299
tert-butyl-[2-(5-hydroxy-1H-indole-2-carbonyl)-1H-indol-5-yl]carbamic acid (PubChem CID 137499299) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is tert-butyl-[2-(5-hydroxy-1H-indole-2-carbonyl)-1H-indol-5-yl]carbamic acid.
| Compound Name | tert-butyl-[2-(5-hydroxy-1H-indole-2-carbonyl)-1H-indol-5-yl]carbamic acid |
|---|---|
| PubChem CID | 137499299 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | tert-butyl-[2-(5-hydroxy-1H-indole-2-carbonyl)-1H-indol-5-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ccc2[nH]c(C(=O)c3cc4cc(O)ccc4[nH]3)cc2c1 |
| InChI | InChI=1S/C22H21N3O4/c1-22(2,3)25(21(28)29)14-4-6-16-12(8-14)10-18(23-16)20(27)19-11-13-9-15(26)5-7-17(13)24-19/h4-11,23-24,26H,1-3H3,(H,28,29) |
| InChIKey | GMKXEMNRAMZHIN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |