C23H27NO3 — CID 1377784
[4-(diethylaminomethyl)-5-hydroxy-2-methyl-1-benzofuran-3-yl]-(3,4-dimethylphenyl)methanone (PubChem CID 1377784) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [4-(diethylaminomethyl)-5-hydroxy-2-methyl-1-benzofuran-3-yl]-(3,4-dimethylphenyl)methanone.
| Compound Name | [4-(diethylaminomethyl)-5-hydroxy-2-methyl-1-benzofuran-3-yl]-(3,4-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 1377784 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [4-(diethylaminomethyl)-5-hydroxy-2-methyl-1-benzofuran-3-yl]-(3,4-dimethylphenyl)methanone |
| SMILES | CCN(CC)Cc1c(O)ccc2oc(C)c(C(=O)c3ccc(C)c(C)c3)c12 |
| InChI | InChI=1S/C23H27NO3/c1-6-24(7-2)13-18-19(25)10-11-20-22(18)21(16(5)27-20)23(26)17-9-8-14(3)15(4)12-17/h8-12,25H,6-7,13H2,1-5H3 |
| InChIKey | IWUGRVSPBJRLPS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|