C22H36Cl2N2O4S — CID 52997302
ethyl 4-(diethylaminomethyl)-2-(diethylaminomethylsulfanylmethyl)-5-hydroxy-1-benzofuran-3-carboxylate;dihydrochloride (PubChem CID 52997302) has the molecular formula C22H36Cl2N2O4S and a molecular weight of 495.51 g/mol. Its IUPAC name is ethyl 4-(diethylaminomethyl)-2-(diethylaminomethylsulfanylmethyl)-5-hydroxy-1-benzofuran-3-carboxylate;dihydrochloride.
| Compound Name | ethyl 4-(diethylaminomethyl)-2-(diethylaminomethylsulfanylmethyl)-5-hydroxy-1-benzofuran-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 52997302 |
| Molecular Formula | C22H36Cl2N2O4S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | ethyl 4-(diethylaminomethyl)-2-(diethylaminomethylsulfanylmethyl)-5-hydroxy-1-benzofuran-3-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1c(CSCN(CC)CC)oc2ccc(O)c(CN(CC)CC)c12.Cl.Cl |
| InChI | InChI=1S/C22H34N2O4S.2ClH/c1-6-23(7-2)13-16-17(25)11-12-18-20(16)21(22(26)27-10-5)19(28-18)14-29-15-24(8-3)9-4;;/h11-12,25H,6-10,13-15H2,1-5H3;2*1H |
| InChIKey | ADBVAQKTECLHEA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|