C20H21ClNO3S- — CID 53352287
1-[4-[(dimethylamino)methyl]-5-hydroxy-2-(phenylsulfanylmethyl)-1-benzofuran-3-yl]ethanone chloride (PubChem CID 53352287) has the molecular formula C20H21ClNO3S- and a molecular weight of 390.91 g/mol. Its IUPAC name is 1-[4-[(dimethylamino)methyl]-5-hydroxy-2-(phenylsulfanylmethyl)-1-benzofuran-3-yl]ethanone chloride.
| Compound Name | 1-[4-[(dimethylamino)methyl]-5-hydroxy-2-(phenylsulfanylmethyl)-1-benzofuran-3-yl]ethanone chloride |
|---|---|
| PubChem CID | 53352287 |
| Molecular Formula | C20H21ClNO3S- |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-[4-[(dimethylamino)methyl]-5-hydroxy-2-(phenylsulfanylmethyl)-1-benzofuran-3-yl]ethanone chloride |
| SMILES | CC(=O)c1c(CSc2ccccc2)oc2ccc(O)c(CN(C)C)c12.[Cl-] |
| InChI | InChI=1S/C20H21NO3S.ClH/c1-13(22)19-18(12-25-14-7-5-4-6-8-14)24-17-10-9-16(23)15(20(17)19)11-21(2)3;/h4-10,23H,11-12H2,1-3H3;1H/p-1 |
| InChIKey | AATWUQPCZJDIAK-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|