C14H12O4S — CID 54724092
3-acetyl-4-hydroxy-6-(phenylsulfanylmethyl)pyran-2-one (PubChem CID 54724092) has the molecular formula C14H12O4S and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-6-(phenylsulfanylmethyl)pyran-2-one.
| Compound Name | 3-acetyl-4-hydroxy-6-(phenylsulfanylmethyl)pyran-2-one |
|---|---|
| PubChem CID | 54724092 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 3-acetyl-4-hydroxy-6-(phenylsulfanylmethyl)pyran-2-one |
| SMILES | CC(=O)c1c(O)cc(CSc2ccccc2)oc1=O |
| InChI | InChI=1S/C14H12O4S/c1-9(15)13-12(16)7-10(18-14(13)17)8-19-11-5-3-2-4-6-11/h2-7,16H,8H2,1H3 |
| InChIKey | YECGOEBUUZTDOO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |