C22H25ClNO4S- — CID 53351254
ethyl 2-(benzylsulfanylmethyl)-4-[(dimethylamino)methyl]-5-hydroxy-1-benzofuran-3-carboxylate chloride (PubChem CID 53351254) has the molecular formula C22H25ClNO4S- and a molecular weight of 434.97 g/mol. Its IUPAC name is ethyl 2-(benzylsulfanylmethyl)-4-[(dimethylamino)methyl]-5-hydroxy-1-benzofuran-3-carboxylate chloride.
| Compound Name | ethyl 2-(benzylsulfanylmethyl)-4-[(dimethylamino)methyl]-5-hydroxy-1-benzofuran-3-carboxylate chloride |
|---|---|
| PubChem CID | 53351254 |
| Molecular Formula | C22H25ClNO4S- |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | ethyl 2-(benzylsulfanylmethyl)-4-[(dimethylamino)methyl]-5-hydroxy-1-benzofuran-3-carboxylate chloride |
| SMILES | CCOC(=O)c1c(CSCc2ccccc2)oc2ccc(O)c(CN(C)C)c12.[Cl-] |
| InChI | InChI=1S/C22H25NO4S.ClH/c1-4-26-22(25)21-19(14-28-13-15-8-6-5-7-9-15)27-18-11-10-17(24)16(20(18)21)12-23(2)3;/h5-11,24H,4,12-14H2,1-3H3;1H/p-1 |
| InChIKey | VOBHSYWFXUQXBF-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|