C11H22ClNO3S — CID 138007946
(2,3-dimethyl-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride (PubChem CID 138007946) has the molecular formula C11H22ClNO3S and a molecular weight of 283.82 g/mol. Its IUPAC name is (2,3-dimethyl-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride.
| Compound Name | (2,3-dimethyl-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride |
|---|---|
| PubChem CID | 138007946 |
| Molecular Formula | C11H22ClNO3S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2,3-dimethyl-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride |
| SMILES | CC1C[N+]2(CCS(=O)(=O)CC2)CC1(C)CO.[Cl-] |
| InChI | InChI=1S/C11H22NO3S.ClH/c1-10-7-12(8-11(10,2)9-13)3-5-16(14,15)6-4-12;/h10,13H,3-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OBSPFSKQWJNNFW-UHFFFAOYSA-M |
| XLogP | -3.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|