C12H22ClNO3S — CID 138007972
3'-methyl-1,1-dioxospiro[1,4-thiazinan-4-ium-4,8'-8-azoniabicyclo[3.2.1]octane]-3'-ol chloride (PubChem CID 138007972) has the molecular formula C12H22ClNO3S and a molecular weight of 295.83 g/mol. Its IUPAC name is 3'-methyl-1,1-dioxospiro[1,4-thiazinan-4-ium-4,8'-8-azoniabicyclo[3.2.1]octane]-3'-ol chloride.
| Compound Name | 3'-methyl-1,1-dioxospiro[1,4-thiazinan-4-ium-4,8'-8-azoniabicyclo[3.2.1]octane]-3'-ol chloride |
|---|---|
| PubChem CID | 138007972 |
| Molecular Formula | C12H22ClNO3S |
| Molecular Weight | 295.83 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3'-methyl-1,1-dioxospiro[1,4-thiazinan-4-ium-4,8'-8-azoniabicyclo[3.2.1]octane]-3'-ol chloride |
| SMILES | CC1(O)CC2CCC(C1)[N+]21CCS(=O)(=O)CC1.[Cl-] |
| InChI | InChI=1S/C12H22NO3S.ClH/c1-12(14)8-10-2-3-11(9-12)13(10)4-6-17(15,16)7-5-13;/h10-11,14H,2-9H2,1H3;1H/q+1;/p-1 |
| InChIKey | YDCCBESDNYPYLH-UHFFFAOYSA-M |
| XLogP | -2.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.83 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|