C13H26NO2S+ — CID 138006218
9-methyl-9-propan-2-yl-3λ6-thia-6-azoniaspiro[5.5]undecane 3,3-dioxide (PubChem CID 138006218) has the molecular formula C13H26NO2S+ and a molecular weight of 260.42 g/mol. Its IUPAC name is 9-methyl-9-propan-2-yl-3λ6-thia-6-azoniaspiro[5.5]undecane 3,3-dioxide.
| Compound Name | 9-methyl-9-propan-2-yl-3λ6-thia-6-azoniaspiro[5.5]undecane 3,3-dioxide |
|---|---|
| PubChem CID | 138006218 |
| Molecular Formula | C13H26NO2S+ |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 9-methyl-9-propan-2-yl-3λ6-thia-6-azoniaspiro[5.5]undecane 3,3-dioxide |
| SMILES | CC(C)C1(C)CC[N+]2(CC1)CCS(=O)(=O)CC2 |
| InChI | InChI=1S/C13H26NO2S/c1-12(2)13(3)4-6-14(7-5-13)8-10-17(15,16)11-9-14/h12H,4-11H2,1-3H3/q+1 |
| InChIKey | HBMRHQUZPDRUIE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|