C9H17ClFNO3S — CID 138046081
(3-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride (PubChem CID 138046081) has the molecular formula C9H17ClFNO3S and a molecular weight of 273.76 g/mol. Its IUPAC name is (3-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride.
| Compound Name | (3-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride |
|---|---|
| PubChem CID | 138046081 |
| Molecular Formula | C9H17ClFNO3S |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (3-fluoro-8,8-dioxo-8λ6-thia-5-azoniaspiro[4.5]decan-3-yl)methanol chloride |
| SMILES | O=S1(=O)CC[N+]2(CCC(F)(CO)C2)CC1.[Cl-] |
| InChI | InChI=1S/C9H17FNO3S.ClH/c10-9(8-12)1-2-11(7-9)3-5-15(13,14)6-4-11;/h12H,1-8H2;1H/q+1;/p-1 |
| InChIKey | YHDWIHDZVIZAQP-UHFFFAOYSA-M |
| XLogP | -3.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|