C9H15BrNO2S+ — CID 138007949
(1'S,5'R)-6'-bromospiro[1,4-thiazinan-4-ium-4,3'-3-azoniabicyclo[3.1.0]hexane] 1,1-dioxide (PubChem CID 138007949) has the molecular formula C9H15BrNO2S+ and a molecular weight of 281.20 g/mol. Its IUPAC name is (1'S,5'R)-6'-bromospiro[1,4-thiazinan-4-ium-4,3'-3-azoniabicyclo[3.1.0]hexane] 1,1-dioxide.
| Compound Name | (1'S,5'R)-6'-bromospiro[1,4-thiazinan-4-ium-4,3'-3-azoniabicyclo[3.1.0]hexane] 1,1-dioxide |
|---|---|
| PubChem CID | 138007949 |
| Molecular Formula | C9H15BrNO2S+ |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (1'S,5'R)-6'-bromospiro[1,4-thiazinan-4-ium-4,3'-3-azoniabicyclo[3.1.0]hexane] 1,1-dioxide |
| SMILES | O=S1(=O)CC[N+]2(CC1)C[C@@H]1C(Br)[C@@H]1C2 |
| InChI | InChI=1S/C9H15BrNO2S/c10-9-7-5-11(6-8(7)9)1-3-14(12,13)4-2-11/h7-9H,1-6H2/q+1/t7-,8+,9? |
| InChIKey | VDXBEZWYCSXOAB-JVHMLUBASA-N |
| XLogP | 0.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|