C10H18NO3S+ — CID 138046090
(3aS,6aR)-spiro[1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ium-5,4'-1,4-thiazinan-4-ium] 1',1'-dioxide (PubChem CID 138046090) has the molecular formula C10H18NO3S+ and a molecular weight of 232.32 g/mol. Its IUPAC name is (3aS,6aR)-spiro[1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ium-5,4'-1,4-thiazinan-4-ium] 1',1'-dioxide.
| Compound Name | (3aS,6aR)-spiro[1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ium-5,4'-1,4-thiazinan-4-ium] 1',1'-dioxide |
|---|---|
| PubChem CID | 138046090 |
| Molecular Formula | C10H18NO3S+ |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3aS,6aR)-spiro[1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-ium-5,4'-1,4-thiazinan-4-ium] 1',1'-dioxide |
| SMILES | O=S1(=O)CC[N+]2(CC1)C[C@H]1COC[C@H]1C2 |
| InChI | InChI=1S/C10H18NO3S/c12-15(13)3-1-11(2-4-15)5-9-7-14-8-10(9)6-11/h9-10H,1-8H2/q+1/t9-,10+ |
| InChIKey | ASZDWMKBYSXRKZ-AOOOYVTPSA-N |
| XLogP | -0.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|