C6H8O7S2 — CID 175774466
4,4,7,7-tetraoxo-1,4,7-oxadithionane-2,9-dione (PubChem CID 175774466) has the molecular formula C6H8O7S2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4,4,7,7-tetraoxo-1,4,7-oxadithionane-2,9-dione.
| Compound Name | 4,4,7,7-tetraoxo-1,4,7-oxadithionane-2,9-dione |
|---|---|
| PubChem CID | 175774466 |
| Molecular Formula | C6H8O7S2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 4,4,7,7-tetraoxo-1,4,7-oxadithionane-2,9-dione |
| SMILES | O=C1CS(=O)(=O)CCS(=O)(=O)CC(=O)O1 |
| InChI | InChI=1S/C6H8O7S2/c7-5-3-14(9,10)1-2-15(11,12)4-6(8)13-5/h1-4H2 |
| InChIKey | YUBHWENLAKCKLW-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|