C6H6F2O3 — CID 54546027
4-(difluoromethyl)oxane-2,6-dione (PubChem CID 54546027) has the molecular formula C6H6F2O3 and a molecular weight of 164.11 g/mol. Its IUPAC name is 4-(difluoromethyl)oxane-2,6-dione.
| Compound Name | 4-(difluoromethyl)oxane-2,6-dione |
|---|---|
| PubChem CID | 54546027 |
| Molecular Formula | C6H6F2O3 |
| Molecular Weight | 164.11 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 4-(difluoromethyl)oxane-2,6-dione |
| SMILES | O=C1CC(C(F)F)CC(=O)O1 |
| InChI | InChI=1S/C6H6F2O3/c7-6(8)3-1-4(9)11-5(10)2-3/h3,6H,1-2H2 |
| InChIKey | ZGPBSGUWDSIJGO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.11 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|