C15H25N5O — CID 138028932
(3S,4S)-N-butyl-3-cyclopropyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidine-1-carboxamide (PubChem CID 138028932) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is (3S,4S)-N-butyl-3-cyclopropyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidine-1-carboxamide.
| Compound Name | (3S,4S)-N-butyl-3-cyclopropyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138028932 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (3S,4S)-N-butyl-3-cyclopropyl-4-(5-methyl-1H-1,2,4-triazol-3-yl)pyrrolidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1C[C@@H](c2n[nH]c(C)n2)[C@H](C2CC2)C1 |
| InChI | InChI=1S/C15H25N5O/c1-3-4-7-16-15(21)20-8-12(11-5-6-11)13(9-20)14-17-10(2)18-19-14/h11-13H,3-9H2,1-2H3,(H,16,21)(H,17,18,19)/t12-,13+/m0/s1 |
| InChIKey | MDNBYSRIQDDUOW-QWHCGFSZSA-N |
| XLogP | 2.05 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|