C13H12N6O2 — CID 138043475
N'-(3-methoxypyrazin-2-yl)-1H-pyrrolo[2,3-b]pyridine-6-carbohydrazide (PubChem CID 138043475) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is N'-(3-methoxypyrazin-2-yl)-1H-pyrrolo[2,3-b]pyridine-6-carbohydrazide.
| Compound Name | N'-(3-methoxypyrazin-2-yl)-1H-pyrrolo[2,3-b]pyridine-6-carbohydrazide |
|---|---|
| PubChem CID | 138043475 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N'-(3-methoxypyrazin-2-yl)-1H-pyrrolo[2,3-b]pyridine-6-carbohydrazide |
| SMILES | COc1nccnc1NNC(=O)c1ccc2cc[nH]c2n1 |
| InChI | InChI=1S/C13H12N6O2/c1-21-13-11(15-6-7-16-13)18-19-12(20)9-3-2-8-4-5-14-10(8)17-9/h2-7H,1H3,(H,14,17)(H,15,18)(H,19,20) |
| InChIKey | YCFSLXQZIPOYHS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|