C14H16ClN3O4 — CID 138050770
methyl (2R)-1-[2-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxoacetyl]pyrrolidine-2-carboxylate (PubChem CID 138050770) has the molecular formula C14H16ClN3O4 and a molecular weight of 325.75 g/mol. Its IUPAC name is methyl (2R)-1-[2-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxoacetyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxoacetyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 138050770 |
| Molecular Formula | C14H16ClN3O4 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | methyl (2R)-1-[2-[(6-chloro-4-methyl-3-pyridinyl)amino]-2-oxoacetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C(=O)C(=O)Nc1cnc(Cl)cc1C |
| InChI | InChI=1S/C14H16ClN3O4/c1-8-6-11(15)16-7-9(8)17-12(19)13(20)18-5-3-4-10(18)14(21)22-2/h6-7,10H,3-5H2,1-2H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | CNYXBLAMECAMAU-SNVBAGLBSA-N |
| XLogP | 1.15 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|