C14H24N2O2 — CID 138057758
tert-butyl N-(1-cyano-3-methylcyclohexyl)-N-methylcarbamate (PubChem CID 138057758) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-3-methylcyclohexyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1-cyano-3-methylcyclohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 138057758 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl N-(1-cyano-3-methylcyclohexyl)-N-methylcarbamate |
| SMILES | CC1CCCC(C#N)(N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H24N2O2/c1-11-7-6-8-14(9-11,10-15)16(5)12(17)18-13(2,3)4/h11H,6-9H2,1-5H3 |
| InChIKey | KYZQDBLWWZOVIA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |