C15H24N2O2 — CID 91271474
tert-butyl N-(1-cyano-4-ethenylcyclohexyl)-N-methylcarbamate (PubChem CID 91271474) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-4-ethenylcyclohexyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1-cyano-4-ethenylcyclohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 91271474 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl N-(1-cyano-4-ethenylcyclohexyl)-N-methylcarbamate |
| SMILES | C=CC1CCC(C#N)(N(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-6-12-7-9-15(11-16,10-8-12)17(5)13(18)19-14(2,3)4/h6,12H,1,7-10H2,2-5H3 |
| InChIKey | GVIFEHSVQWMITJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|