C7H12N4O2 — CID 138059552
5-amino-6-imino-3-propyl-1,3-diazinane-2,4-dione (PubChem CID 138059552) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 5-amino-6-imino-3-propyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-amino-6-imino-3-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 138059552 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-amino-6-imino-3-propyl-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C(=O)C1N |
| InChI | InChI=1S/C7H12N4O2/c1-2-3-11-6(12)4(8)5(9)10-7(11)13/h4H,2-3,8H2,1H3,(H2,9,10,13) |
| InChIKey | VSPTWCZRNWBWOK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|