C9H13FN4O4 — CID 143895771
fluoro 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate (PubChem CID 143895771) has the molecular formula C9H13FN4O4 and a molecular weight of 260.22 g/mol. Its IUPAC name is fluoro 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate.
| Compound Name | fluoro 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate |
|---|---|
| PubChem CID | 143895771 |
| Molecular Formula | C9H13FN4O4 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | fluoro 2-[(4-imino-2,6-dioxo-1-propyl-1,3-diazinan-5-yl)amino]acetate |
| SMILES | [H]/N=C1\NC(=O)N(CCC)C(=O)C1NCC(=O)OF |
| InChI | InChI=1S/C9H13FN4O4/c1-2-3-14-8(16)6(7(11)13-9(14)17)12-4-5(15)18-10/h6,12H,2-4H2,1H3,(H2,11,13,17) |
| InChIKey | HMNVDCOSTWAOQA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|