C13H20N5O4+ — CID 77115485
2-[8-(butan-2-ylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid (PubChem CID 77115485) has the molecular formula C13H20N5O4+ and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[8-(butan-2-ylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid.
| Compound Name | 2-[8-(butan-2-ylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
|---|---|
| PubChem CID | 77115485 |
| Molecular Formula | C13H20N5O4+ |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[8-(butan-2-ylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
| SMILES | CCC(C)NC1=[N+](CC(=O)O)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C13H19N5O4/c1-5-7(2)14-12-15-10-9(18(12)6-8(19)20)11(21)17(4)13(22)16(10)3/h7,9H,5-6H2,1-4H3,(H,19,20)/p+1 |
| InChIKey | ZMSJWIQBOFYDON-UHFFFAOYSA-O |
| XLogP | -0.87 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|