C13H15BF8N2O2 — CID 138109701
1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrazole (PubChem CID 138109701) has the molecular formula C13H15BF8N2O2 and a molecular weight of 394.07 g/mol. Its IUPAC name is 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrazole.
| Compound Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 138109701 |
| Molecular Formula | C13H15BF8N2O2 |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H15BF8N2O2/c1-9(2)10(3,4)26-14(25-9)8-6(12(17,18)19)7(23-24(8)5)11(15,16)13(20,21)22/h1-5H3 |
| InChIKey | SRBNGMPYBONZCK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|