C9H13N3O2Se — CID 138115463
4-amino-1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one (PubChem CID 138115463) has the molecular formula C9H13N3O2Se and a molecular weight of 274.18 g/mol. Its IUPAC name is 4-amino-1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 138115463 |
| Molecular Formula | C9H13N3O2Se |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 4-amino-1-[(2S,5R)-5-(hydroxymethyl)selenolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2CC[C@H](CO)[Se]2)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O2Se/c10-7-3-4-12(9(14)11-7)8-2-1-6(5-13)15-8/h3-4,6,8,13H,1-2,5H2,(H2,10,11,14)/t6-,8+/m1/s1 |
| InChIKey | MGDLOMKNFCDRTA-SVRRBLITSA-N |
| XLogP | -0.40 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|