C32H54O4 — CID 138145898
(7Z,10Z,13Z)-9-[(Z)-hexadec-9-enoyl]oxyhexadeca-7,10,13-trienoic acid (PubChem CID 138145898) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is (7Z,10Z,13Z)-9-[(Z)-hexadec-9-enoyl]oxyhexadeca-7,10,13-trienoic acid.
| Compound Name | (7Z,10Z,13Z)-9-[(Z)-hexadec-9-enoyl]oxyhexadeca-7,10,13-trienoic acid |
|---|---|
| PubChem CID | 138145898 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | (7Z,10Z,13Z)-9-[(Z)-hexadec-9-enoyl]oxyhexadeca-7,10,13-trienoic acid |
| SMILES | CC/C=C\C/C=C\C(/C=C\CCCCCC(=O)O)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C32H54O4/c1-3-5-7-9-10-11-12-13-14-15-16-21-25-29-32(35)36-30(26-22-18-8-6-4-2)27-23-19-17-20-24-28-31(33)34/h6,8,11-12,22-23,26-27,30H,3-5,7,9-10,13-21,24-25,28-29H2,1-2H3,(H,33,34)/b8-6-,12-11-,26-22-,27-23- |
| InChIKey | DPBNOFHVOHLANQ-WGCNJLGDSA-N |
| XLogP | 9.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|