C24H23FN6O2 — CID 1383191
8-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 1383191) has the molecular formula C24H23FN6O2 and a molecular weight of 446.49 g/mol. Its IUPAC name is 8-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 1383191 |
| Molecular Formula | C24H23FN6O2 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 8-[2-(3,4-dihydro-2H-naphthalen-1-ylidene)hydrazinyl]-7-[(4-fluorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NN=C3CCCc4ccccc43)n2Cc2ccc(F)cc2)n(C)c1=O |
| InChI | InChI=1S/C24H23FN6O2/c1-29-21-20(22(32)30(2)24(29)33)31(14-15-10-12-17(25)13-11-15)23(26-21)28-27-19-9-5-7-16-6-3-4-8-18(16)19/h3-4,6,8,10-13H,5,7,9,14H2,1-2H3,(H,26,28) |
| InChIKey | DPQZJHQLTOUGPF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|