C22H13N3O2S — CID 138374051
6-(1,3-benzothiazol-2-yl)-3-(pyridin-4-yliminomethyl)chromen-4-one (PubChem CID 138374051) has the molecular formula C22H13N3O2S and a molecular weight of 383.43 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)-3-(pyridin-4-yliminomethyl)chromen-4-one.
| Compound Name | 6-(1,3-benzothiazol-2-yl)-3-(pyridin-4-yliminomethyl)chromen-4-one |
|---|---|
| PubChem CID | 138374051 |
| Molecular Formula | C22H13N3O2S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)-3-(pyridin-4-yliminomethyl)chromen-4-one |
| SMILES | O=c1c(/C=N/c2ccncc2)coc2ccc(-c3nc4ccccc4s3)cc12 |
| InChI | InChI=1S/C22H13N3O2S/c26-21-15(12-24-16-7-9-23-10-8-16)13-27-19-6-5-14(11-17(19)21)22-25-18-3-1-2-4-20(18)28-22/h1-13H/b24-12+ |
| InChIKey | CSXQFCZHDHZTNI-WYMPLXKRSA-N |
| XLogP | 5.22 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|