C11H12F7NO5 — CID 138395061
(4R)-5-ethoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoic acid (PubChem CID 138395061) has the molecular formula C11H12F7NO5 and a molecular weight of 371.21 g/mol. Its IUPAC name is (4R)-5-ethoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoic acid.
| Compound Name | (4R)-5-ethoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138395061 |
| Molecular Formula | C11H12F7NO5 |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (4R)-5-ethoxy-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-5-oxopentanoic acid |
| SMILES | CCOC(=O)[C@@H](CCC(=O)O)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F7NO5/c1-2-24-7(22)5(3-4-6(20)21)19-8(23)9(12,13)10(14,15)11(16,17)18/h5H,2-4H2,1H3,(H,19,23)(H,20,21)/t5-/m1/s1 |
| InChIKey | FYWCNWDCUWMVFO-RXMQYKEDSA-N |
| XLogP | 1.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|