C11H24Cl3N — CID 138396609
N-butyl-N-(2,3-dichloropropyl)butan-1-amine;hydrochloride (PubChem CID 138396609) has the molecular formula C11H24Cl3N and a molecular weight of 276.68 g/mol. Its IUPAC name is N-butyl-N-(2,3-dichloropropyl)butan-1-amine;hydrochloride.
| Compound Name | N-butyl-N-(2,3-dichloropropyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 138396609 |
| Molecular Formula | C11H24Cl3N |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-butyl-N-(2,3-dichloropropyl)butan-1-amine;hydrochloride |
| SMILES | CCCCN(CCCC)CC(Cl)CCl.Cl |
| InChI | InChI=1S/C11H23Cl2N.ClH/c1-3-5-7-14(8-6-4-2)10-11(13)9-12;/h11H,3-10H2,1-2H3;1H |
| InChIKey | UKWGHWRAJKOQPD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|