C10H14N4O4 — CID 138399228
diaminomethylidene-(7-methyl-2,3-dihydro-1-benzofuran-3-yl)azanium nitrate (PubChem CID 138399228) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is diaminomethylidene-(7-methyl-2,3-dihydro-1-benzofuran-3-yl)azanium nitrate.
| Compound Name | diaminomethylidene-(7-methyl-2,3-dihydro-1-benzofuran-3-yl)azanium nitrate |
|---|---|
| PubChem CID | 138399228 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | diaminomethylidene-(7-methyl-2,3-dihydro-1-benzofuran-3-yl)azanium nitrate |
| SMILES | Cc1cccc2c1OCC2[NH+]=C(N)N.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C10H13N3O.NO3/c1-6-3-2-4-7-8(13-10(11)12)5-14-9(6)7;2-1(3)4/h2-4,8H,5H2,1H3,(H4,11,12,13);/q;-1/p+1 |
| InChIKey | UIPRULKYMQYIQR-UHFFFAOYSA-O |
| XLogP | -1.46 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|