C18H23ClN4O3 — CID 138399379
(2S)-2-amino-3-[4-hydroxy-3-[[4-(trimethylazaniumyl)phenyl]diazenyl]phenyl]propanoate;hydrochloride (PubChem CID 138399379) has the molecular formula C18H23ClN4O3 and a molecular weight of 378.86 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-hydroxy-3-[[4-(trimethylazaniumyl)phenyl]diazenyl]phenyl]propanoate;hydrochloride.
| Compound Name | (2S)-2-amino-3-[4-hydroxy-3-[[4-(trimethylazaniumyl)phenyl]diazenyl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 138399379 |
| Molecular Formula | C18H23ClN4O3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2S)-2-amino-3-[4-hydroxy-3-[[4-(trimethylazaniumyl)phenyl]diazenyl]phenyl]propanoate;hydrochloride |
| SMILES | C[N+](C)(C)c1ccc(/N=N/c2cc(C[C@H](N)C(=O)[O-])ccc2O)cc1.Cl |
| InChI | InChI=1S/C18H22N4O3.ClH/c1-22(2,3)14-7-5-13(6-8-14)20-21-16-11-12(4-9-17(16)23)10-15(19)18(24)25;/h4-9,11,15H,10,19H2,1-3H3,(H-,20,23,24,25);1H/t15-;/m0./s1 |
| InChIKey | XEKVBIXIBCYLRT-RSAXXLAASA-N |
| XLogP | 2.05 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|