C22H31N5O8P+ — CID 174295811
2-[[4-[[5-[(2S)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]-2-hydroxyphenyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 174295811) has the molecular formula C22H31N5O8P+ and a molecular weight of 524.49 g/mol. Its IUPAC name is 2-[[4-[[5-[(2S)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]-2-hydroxyphenyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[4-[[5-[(2S)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]-2-hydroxyphenyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 174295811 |
| Molecular Formula | C22H31N5O8P+ |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 2-[[4-[[5-[(2S)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]-2-hydroxyphenyl]diazenyl]phenoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCOP(=O)(O)Oc1ccc(/N=N/c2cc(C[C@H](NC(=O)CN)C(=O)O)ccc2O)cc1 |
| InChI | InChI=1S/C22H30N5O8P/c1-27(2,3)10-11-34-36(32,33)35-17-7-5-16(6-8-17)25-26-18-12-15(4-9-20(18)28)13-19(22(30)31)24-21(29)14-23/h4-9,12,19H,10-11,13-14,23H2,1-3H3,(H3-,24,25,28,29,30,31,32,33)/p+1/t19-/m0/s1 |
| InChIKey | QGFMSFULWNHXOY-IBGZPJMESA-O |
| XLogP | 2.08 |
| TPSA | 193.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|