C11H12N6 — CID 138453983
2,13-dimethyl-4,6,11,13-tetrazatricyclo[8.3.0.03,7]trideca-1(10),2,4,6,8,11-hexaene-5,12-diamine (PubChem CID 138453983) has the molecular formula C11H12N6 and a molecular weight of 228.26 g/mol. Its IUPAC name is 2,13-dimethyl-4,6,11,13-tetrazatricyclo[8.3.0.03,7]trideca-1(10),2,4,6,8,11-hexaene-5,12-diamine.
| Compound Name | 2,13-dimethyl-4,6,11,13-tetrazatricyclo[8.3.0.03,7]trideca-1(10),2,4,6,8,11-hexaene-5,12-diamine |
|---|---|
| PubChem CID | 138453983 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,13-dimethyl-4,6,11,13-tetrazatricyclo[8.3.0.03,7]trideca-1(10),2,4,6,8,11-hexaene-5,12-diamine |
| SMILES | Cc1c2nc(N)nc-2ccc2nc(N)n(C)c12 |
| InChI | InChI=1S/C11H12N6/c1-5-8-6(14-10(12)16-8)3-4-7-9(5)17(2)11(13)15-7/h3-4H,1-2H3,(H2,13,15)(H2,12,14,16) |
| InChIKey | DQQICZZFBGDLKE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |