C7H11NO4 — CID 138460855
3-acetyl-3,6-dihydroxypiperidin-2-one (PubChem CID 138460855) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-acetyl-3,6-dihydroxypiperidin-2-one.
| Compound Name | 3-acetyl-3,6-dihydroxypiperidin-2-one |
|---|---|
| PubChem CID | 138460855 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-acetyl-3,6-dihydroxypiperidin-2-one |
| SMILES | CC(=O)C1(O)CCC(O)NC1=O |
| InChI | InChI=1S/C7H11NO4/c1-4(9)7(12)3-2-5(10)8-6(7)11/h5,10,12H,2-3H2,1H3,(H,8,11) |
| InChIKey | SVIUXERKPNPHFT-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|