C29H30O8 — CID 138462473
[4-[4-methyl-4,6-bis(2-methylprop-2-enoyloxy)cyclohexa-1,5-dien-1-yl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate (PubChem CID 138462473) has the molecular formula C29H30O8 and a molecular weight of 506.55 g/mol. Its IUPAC name is [4-[4-methyl-4,6-bis(2-methylprop-2-enoyloxy)cyclohexa-1,5-dien-1-yl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-methyl-4,6-bis(2-methylprop-2-enoyloxy)cyclohexa-1,5-dien-1-yl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138462473 |
| Molecular Formula | C29H30O8 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | [4-[4-methyl-4,6-bis(2-methylprop-2-enoyloxy)cyclohexa-1,5-dien-1-yl]-3-(2-methylprop-2-enoyloxy)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC(C)(OC(=O)C(=C)C)CC=C1c1ccc(OC(=O)C(=C)C)cc1OC(=O)C(=C)C |
| InChI | InChI=1S/C29H30O8/c1-16(2)25(30)34-20-10-11-21(23(14-20)35-26(31)17(3)4)22-12-13-29(9,37-28(33)19(7)8)15-24(22)36-27(32)18(5)6/h10-12,14-15H,1,3,5,7,13H2,2,4,6,8-9H3 |
| InChIKey | ZBPCAFVCGBCEMD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|