C18H17ClN2O6 — CID 138466780
tert-butyl 3-(4-chloro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidine-1-carboxylate (PubChem CID 138466780) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is tert-butyl 3-(4-chloro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-chloro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 138466780 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | tert-butyl 3-(4-chloro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)CCC(N2C(=O)c3cccc(Cl)c3C2=O)C1=O |
| InChI | InChI=1S/C18H17ClN2O6/c1-18(2,3)27-17(26)21-12(22)8-7-11(15(21)24)20-14(23)9-5-4-6-10(19)13(9)16(20)25/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | WWAAHCWXEZKHAP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|