C30H40N4O10 — CID 166452034
tert-butyl [2-[1-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl] carbonate (PubChem CID 166452034) has the molecular formula C30H40N4O10 and a molecular weight of 616.67 g/mol. Its IUPAC name is tert-butyl [2-[1-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl] carbonate.
| Compound Name | tert-butyl [2-[1-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl] carbonate |
|---|---|
| PubChem CID | 166452034 |
| Molecular Formula | C30H40N4O10 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | tert-butyl [2-[1-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-1,3-dioxoisoindol-4-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)CN1C(=O)CCC(N2C(=O)c3cccc(OC(=O)OC(C)(C)C)c3C2=O)C1=O |
| InChI | InChI=1S/C30H40N4O10/c1-29(2,3)43-27(40)32-16-9-7-8-15-31-21(35)17-33-22(36)14-13-19(25(33)38)34-24(37)18-11-10-12-20(23(18)26(34)39)42-28(41)44-30(4,5)6/h10-12,19H,7-9,13-17H2,1-6H3,(H,31,35)(H,32,40) |
| InChIKey | WUDPPABYVQVZRQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|