C12H15BrO — CID 138467946
[(1S,3R)-3-(4-bromophenyl)cyclopentyl]methanol (PubChem CID 138467946) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is [(1S,3R)-3-(4-bromophenyl)cyclopentyl]methanol.
| Compound Name | [(1S,3R)-3-(4-bromophenyl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 138467946 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | [(1S,3R)-3-(4-bromophenyl)cyclopentyl]methanol |
| SMILES | OC[C@H]1CC[C@@H](c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C12H15BrO/c13-12-5-3-10(4-6-12)11-2-1-9(7-11)8-14/h3-6,9,11,14H,1-2,7-8H2/t9-,11+/m0/s1 |
| InChIKey | GSQQGJGGQNJUBG-GXSJLCMTSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |