C17H25BrO4 — CID 172617819
[3-(4-bromophenyl)-5-propan-2-yloxycyclohexyl]methanol;formic acid (PubChem CID 172617819) has the molecular formula C17H25BrO4 and a molecular weight of 373.29 g/mol. Its IUPAC name is [3-(4-bromophenyl)-5-propan-2-yloxycyclohexyl]methanol;formic acid.
| Compound Name | [3-(4-bromophenyl)-5-propan-2-yloxycyclohexyl]methanol;formic acid |
|---|---|
| PubChem CID | 172617819 |
| Molecular Formula | C17H25BrO4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [3-(4-bromophenyl)-5-propan-2-yloxycyclohexyl]methanol;formic acid |
| SMILES | CC(C)OC1CC(CO)CC(c2ccc(Br)cc2)C1.O=CO |
| InChI | InChI=1S/C16H23BrO2.CH2O2/c1-11(2)19-16-8-12(10-18)7-14(9-16)13-3-5-15(17)6-4-13;2-1-3/h3-6,11-12,14,16,18H,7-10H2,1-2H3;1H,(H,2,3) |
| InChIKey | CGGDEVYUBSGWED-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|