C12H23N6O12P3 — CID 138473702
[[(2R,3S,4R,5R)-4-amino-3-hydroxy-4-methyl-5-[4-(N'-methylcarbamimidoyl)-5-(methylideneamino)imidazol-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138473702) has the molecular formula C12H23N6O12P3 and a molecular weight of 536.27 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-amino-3-hydroxy-4-methyl-5-[4-(N'-methylcarbamimidoyl)-5-(methylideneamino)imidazol-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-4-amino-3-hydroxy-4-methyl-5-[4-(N'-methylcarbamimidoyl)-5-(methylideneamino)imidazol-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138473702 |
| Molecular Formula | C12H23N6O12P3 |
| Molecular Weight | 536.27 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-amino-3-hydroxy-4-methyl-5-[4-(N'-methylcarbamimidoyl)-5-(methylideneamino)imidazol-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=Nc1c(/C(N)=N/C)ncn1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]1(C)N |
| InChI | InChI=1S/C12H23N6O12P3/c1-12(14)8(19)6(4-27-32(23,24)30-33(25,26)29-31(20,21)22)28-11(12)18-5-17-7(9(13)15-2)10(18)16-3/h5-6,8,11,19H,3-4,14H2,1-2H3,(H2,13,15)(H,23,24)(H,25,26)(H2,20,21,22)/t6-,8-,11-,12-/m1/s1 |
| InChIKey | UEFMSQLNHIELEB-YUTYNTIBSA-N |
| XLogP | -1.13 |
| TPSA | 283.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.27 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|