C22H20ClF3N4O3 — CID 138483296
N-[[4-chloro-3-[4-(3,4-dimethylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2-methoxypropanamide (PubChem CID 138483296) has the molecular formula C22H20ClF3N4O3 and a molecular weight of 480.87 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-(3,4-dimethylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2-methoxypropanamide.
| Compound Name | N-[[4-chloro-3-[4-(3,4-dimethylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2-methoxypropanamide |
|---|---|
| PubChem CID | 138483296 |
| Molecular Formula | C22H20ClF3N4O3 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-[[4-chloro-3-[4-(3,4-dimethylphenyl)-6-oxo-1H-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2-methoxypropanamide |
| SMILES | COC(C(=O)NCc1ccc(Cl)c(-c2nc(-c3ccc(C)c(C)c3)nc(=O)[nH]2)c1)C(F)(F)F |
| InChI | InChI=1S/C22H20ClF3N4O3/c1-11-4-6-14(8-12(11)2)18-28-19(30-21(32)29-18)15-9-13(5-7-16(15)23)10-27-20(31)17(33-3)22(24,25)26/h4-9,17H,10H2,1-3H3,(H,27,31)(H,28,29,30,32) |
| InChIKey | XPONPWPNFXLHAH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |