C13H24N4O2 — CID 138495673
1,3-diamino-1-[(2Z,4Z)-4-ethenyl-3-(methoxymethyl)hepta-2,4-dien-2-yl]-3-methylurea (PubChem CID 138495673) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,3-diamino-1-[(2Z,4Z)-4-ethenyl-3-(methoxymethyl)hepta-2,4-dien-2-yl]-3-methylurea.
| Compound Name | 1,3-diamino-1-[(2Z,4Z)-4-ethenyl-3-(methoxymethyl)hepta-2,4-dien-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 138495673 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1,3-diamino-1-[(2Z,4Z)-4-ethenyl-3-(methoxymethyl)hepta-2,4-dien-2-yl]-3-methylurea |
| SMILES | C=CC(=C/CC)/C(COC)=C(\C)N(N)C(=O)N(C)N |
| InChI | InChI=1S/C13H24N4O2/c1-6-8-11(7-2)12(9-19-5)10(3)17(15)13(18)16(4)14/h7-8H,2,6,9,14-15H2,1,3-5H3/b11-8-,12-10+ |
| InChIKey | HPHXPCKDJIUJFA-XNGMQHMOSA-N |
| XLogP | 1.53 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|